Compound Q&A

What is N-(1,3-Benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxybenzyl)amino]benzenesulfonamide (CAS: 1532593-30-8)?

Answer

N-(1,3-Benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxybenzyl)amino]benzenesulfonamide
N-(1,3-Benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxybenzyl)amino]benzenesulfonamide is a complex organic compound with a molecular structure that includes a benzothiazole ring and a sulfonamide group. It is a white crystalline solid with a defined melting point and solubility in water and organic solvents.

About

English Name N-(1,3-Benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxybenzyl)amino]benzenesulfonamide
Molecular Formula C21H19N3O4S2
Molecular Weight 441.53 g/mol
SMILES COc1cccc(c1O)CNc2ccc(cc2)S(=O)(=O)Nc3nc4ccccc4s3
InChIKey OWHBVKBNNRYMIN-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What are the main uses of N-(1,3-Benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxybenzyl)amino]benzenesulfonamide (CAS: 1532593-30-8)?

This compound is primarily used in pharmaceutical applications for its potential therapeutic effects...

Compound Q&A

Is N-(1,3-Benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxybenzyl)amino]benzenesulfonamide (CAS: 1532593-30-8) safe?

The compound is generally considered safe under normal handling conditions. However, it should be us...

Compound Q&A

How should N-(1,3-Benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxybenzyl)amino]benzenesulfonamide (CAS: 1532593-30-8) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...