Compound Q&A

How should 3-Bromo-5-quinolinecarboxylic acid (CAS: 1344046-12-3) be stored?

Answer

3-Bromo-5-quinolinecarboxylic acid
3-Bromo-5-quinolinecarboxylic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. Store it in a tightly closed container to prevent moisture absorption. Maintain a temperature below 25°C and avoid exposure to extreme humidity conditions.

About

English Name 3-Bromo-5-quinolinecarboxylic acid
Molecular Formula C10H6BrNO2
Molecular Weight 252.07 g/mol
SMILES Brc1cnc2c(c1)c(ccc2)C(=O)O
InChIKey AHSLKFZOVNDIDM-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is 3-Bromo-5-quinolinecarboxylic acid (CAS: 1344046-12-3)?

3-Bromo-5-quinolinecarboxylic acid is an organic compound with the CAS number 1344046-12-3. It has t...

Compound Q&A

What are the main uses of 3-Bromo-5-quinolinecarboxylic acid (CAS: 1344046-12-3)?

3-Bromo-5-quinolinecarboxylic acid is primarily used in pharmaceutical research for developing new d...

Compound Q&A

Is 3-Bromo-5-quinolinecarboxylic acid (CAS: 1344046-12-3) safe?

3-Bromo-5-quinolinecarboxylic acid is generally considered safe when handled with appropriate precau...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...