Compound Q&A

What are the main uses of Methyl 1-hydroxy-9H-carbazole-3-carboxylate (CAS: 182261-83-2)?

Answer

Methyl 1-hydroxy-9H-carbazole-3-carboxylate
Methyl 1-hydroxy-9H-carbazole-3-carboxylate (CAS: 182261-83-2) is primarily used in the synthesis of other organic compounds. It is a key intermediate in the development of dyes, pharmaceuticals, and materials with aromatic properties. Its use in research focuses on exploring its potential in various chemical applications.

About

English Name Methyl 1-hydroxy-9H-carbazole-3-carboxylate
Molecular Formula C14H11NO3
Molecular Weight 241.25 g/mol
SMILES COC(=O)c1cc2c3ccccc3[nH]c2c(c1)O
InChIKey ZWPODTIRGFOENJ-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is Methyl 1-hydroxy-9H-carbazole-3-carboxylate (CAS: 182261-83-2)?

Methyl 1-hydroxy-9H-carbazole-3-carboxylate (CAS: 182261-83-2) is an organic compound with the molec...

Compound Q&A

Is Methyl 1-hydroxy-9H-carbazole-3-carboxylate (CAS: 182261-83-2) safe?

Methyl 1-hydroxy-9H-carbazole-3-carboxylate (CAS: 182261-83-2) is generally considered safe for labo...

Compound Q&A

How should Methyl 1-hydroxy-9H-carbazole-3-carboxylate (CAS: 182261-83-2) be stored?

Methyl 1-hydroxy-9H-carbazole-3-carboxylate (CAS: 182261-83-2) should be stored in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...