Compound Q&A

Is Euphorbia factor L7a (CAS: 93550-94-8) safe?

Answer

Euphorbia factor L7a
Euphorbia factor L7a (CAS: 93550-94-8) is generally considered safe in controlled research environments. However, it should be handled with care due to its potential cytotoxic effects. Protective measures such as gloves and laboratory coats are recommended.

About

CAS No 93550-94-8
English Name Euphorbia factor L7a
Molecular Formula C33H40O7
Molecular Weight 548.67 g/mol
SMILES CC1CC2(C(C1OC(=O)C=CC3=CC=CC=C3)C=C(CCC4C(C4(C)C)C=C(C2=O)C)COC(=O)C)OC(=O)C
InChIKey NMTNFTPLDSEWKL-UKHUQMCYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is Euphorbia factor L7a (CAS: 93550-94-8)?

Euphorbia factor L7a (CAS: 93550-94-8) is a bioactive compound extracted from Euphorbia plants, know...

Compound Q&A

What are the main uses of Euphorbia factor L7a (CAS: 93550-94-8)?

Euphorbia factor L7a (CAS: 93550-94-8) is primarily used in pharmaceutical research for its anti-inf...

Compound Q&A

How should Euphorbia factor L7a (CAS: 93550-94-8) be stored?

Euphorbia factor L7a (CAS: 93550-94-8) should be stored in a cool, dry place away from direct sunlig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...