Compound Q&A

What is Urea, dimethyldiphenyl- (CAS: 65923-65-1)?

Answer

Urea, dimethyldiphenyl-
Urea, dimethyldiphenyl- (CAS: 65923-65-1) is a chemical compound characterized by its aromatic structure with urea functionality. It has the molecular formula C12H13N2O. This compound is used in various applications such as pharmaceuticals, dyes, and resins due to its unique chemical properties.

About

CAS No 65923-65-1
English Name Urea, dimethyldiphenyl-
Molecular Formula C15H16N2O
Molecular Weight 240.3 g/mol
SMILES O=C(N(C)C)N(C1C=CC=CC=1)C1C=CC=CC=1
InChIKey JPMQWSJHCDLANT-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What are the main uses of Urea, dimethyldiphenyl- (CAS: 65923-65-1)?

Urea, dimethyldiphenyl- (CAS: 65923-65-1) is primarily used in the production of pharmaceuticals, dy...

Compound Q&A

Is Urea, dimethyldiphenyl- (CAS: 65923-65-1) safe?

Urea, dimethyldiphenyl- (CAS: 65923-65-1) is generally considered safe for industrial use when handl...

Compound Q&A

How should Urea, dimethyldiphenyl- (CAS: 65923-65-1) be stored?

Urea, dimethyldiphenyl- (CAS: 65923-65-1) should be stored in a cool, dry place away from direct sun...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...