Compound Q&A

Are there alternatives to 2-(4-{2-[(3,5-Dimethylphenyl)amino]-2-oxoethyl}phenoxy)-2-methylpropanoic acid (CAS: 131179-95-8) in synthesis?

Answer

2-(4-{2-[(3,5-Dimethylphenyl)amino]-2-oxoethyl}phenoxy)-2-methylpropanoic acid
There are alternative reagents and synthesis methods that can be considered. For instance, using 2-methylpropanoic acid and 4-{2-[(3,5-dimethylphenyl)amino]-2-oxoethyl}phenol as starting materials can yield similar compounds. Additionally, other amino acids or modified amino acids can serve as alternatives, depending on the desired properties of the final product.

About

English Name 2-(4-{2-[(3,5-Dimethylphenyl)amino]-2-oxoethyl}phenoxy)-2-methylpropanoic acid
Molecular Formula C20H23NO4
Molecular Weight 341.41 g/mol
SMILES CC1=CC(=CC(=C1)NC(=O)CC2=CC=C(C=C2)OC(C)(C)C(=O)O)C
InChIKey BNFRJXLZYUTIII-UHFFFAOYSA-N
Last Updated: 2025-12-26 17:17

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-(4-{2-[(3,5-Dimethylphenyl)amino]-2-oxoethyl}phenoxy)-2-methylpropanoic acid (CAS: 131179-95-8)?

This compound (CAS: 131179-95-8) falls under the European Union’s REACH regulation for chemicals and...

Compound Q&A

What is the market or research trend for 2-(4-{2-[(3,5-Dimethylphenyl)amino]-2-oxoethyl}phenoxy)-2-methylpropanoic acid (CAS: 131179-95-8)?

The market for this compound (CAS: 131179-95-8) is driven by its applications in pharmaceuticals and...

Compound Q&A

How should waste containing 2-(4-{2-[(3,5-Dimethylphenyl)amino]-2-oxoethyl}phenoxy)-2-methylpropanoic acid (CAS: 131179-95-8) be handled?

Waste containing this compound (CAS: 131179-95-8) should be collected in sealed containers and dispo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...