Compound Q&A

How should waste containing Echinocandin B (CAS: 54651-05-7) be handled?

Answer

Echinocandin B
Waste containing Echinocandin B (CAS: 54651-05-7) should be collected in appropriate containers and stored separately to prevent contamination. Incineration is a common method for disposal, while professional waste disposal services can ensure compliance with environmental regulations. Proper labeling, documentation, and adherence to local and national disposal guidelines are essential to manage waste safely and responsibly.

About

CAS No 54651-05-7
English Name Echinocandin B
Molecular Formula C52H81N7O16
Molecular Weight 1060.24 g/mol
SMILES CCCCC/C=C\C/C=C\CCCCCCCC(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@@H]2[C@@H](O)[C@H](CN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]2N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[C@@H](C2)O)[C@@H]([C@H](c1ccc(cc1)O)O)O)[C@H](O)C)C
InChIKey FAUOJMHVEYMQQG-HVYQDZECSA-N
Last Updated: 2025-12-26 12:08

Related Q&A

Compound Q&A

What regulatory guidelines apply to Echinocandin B (CAS: 54651-05-7)?

Echinocandin B (CAS: 54651-05-7) is subject to various regulatory guidelines including the Globally ...

Compound Q&A

Are there alternatives to Echinocandin B in synthesis?

Yes, there are alternatives to Echinocandin B in synthesis. Commonly used analogs include echinocand...

Compound Q&A

What is the market or research trend for Echinocandin B (CAS: 54651-05-7)?

The market for Echinocandin B (CAS: 54651-05-7) is driven by ongoing research in antifungal drug dev...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...