Compound Q&A

What is the market or research trend for (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole?

Answer

(3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole
The market for (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole is growing due to its unique structure and potential applications. Research trends are focusing on its use in medicinal chemistry, as a scaffold for drug discovery, and in the development of novel materials. The increasing demand in pharmaceutical and materials science industries is driving the market forward.

About

English Name (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole
Molecular Formula C23H22BNO
Molecular Weight 339.24700000000007 g/mol
SMILES B1(N2CCCC2C(O1)(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5
InChIKey GXAMQZFEKIDKAP-JOCHJYFZSA-N
Last Updated: 2025-12-26 12:08

Related Q&A

Compound Q&A

What regulatory guidelines apply to (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole (CAS: 145238-45-5)?

The compound (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole is subject to the G...

Compound Q&A

Are there alternatives to (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole in synthesis?

In synthesis, there are various alternatives to (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,...

Compound Q&A

How should waste containing (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole be handled?

Waste containing (3aR)-1,3,3-Triphenyltetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaborole should be colle...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A