Compound Q&A

Are there alternatives to 4-[4-(Acryloyloxy)butoxy]benzoic acid (CAS: 69260-42-0) in synthesis?

Answer

4-[4-(Acryloyloxy)butoxy]benzoic acid
Alternatives to 4-[4-(Acryloyloxy)butoxy]benzoic acid (CAS: 69260-42-0) in synthesis include similar carboxylic acids with different functional groups, such as acrylic acid or methacrylic acid. Isomers and analogs like 2-acrylamido-2-methylpropanesulfonic acid can also be considered depending on the specific application requirements.

About

CAS No 69260-42-0
English Name 4-[4-(Acryloyloxy)butoxy]benzoic acid
Molecular Formula C14H16O5
Molecular Weight 264.28 g/mol
SMILES C=CC(=O)OCCCCOC1=CC=C(C=C1)C(=O)O
InChIKey ZBWYHNHRVUSVNU-UHFFFAOYSA-N
Last Updated: 2025-12-26 12:08

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-[4-(Acryloyloxy)butoxy]benzoic acid (CAS: 69260-42-0)?

4-[4-(Acryloyloxy)butoxy]benzoic acid (CAS: 69260-42-0) falls under various regulatory guidelines. I...

Compound Q&A

What is the market or research trend for 4-[4-(Acryloyloxy)butoxy]benzoic acid (CAS: 69260-42-0)?

The market for 4-[4-(Acryloyloxy)butoxy]benzoic acid (CAS: 69260-42-0) is growing due to its applica...

Compound Q&A

How should waste containing 4-[4-(Acryloyloxy)butoxy]benzoic acid (CAS: 69260-42-0) be handled?

Waste containing 4-[4-(Acryloyloxy)butoxy]benzoic acid (CAS: 69260-42-0) should be collected in appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...