Compound Q&A

Are there alternatives to 2,4-Dinitrobenzenesulfonic acid hydrate (CAS: 698999-22-3) in synthesis?

Answer

2,4-Dinitrobenzenesulfonic acid hydrate
In synthesis, alternatives to 2,4-Dinitrobenzenesulfonic acid hydrate (CAS: 698999-22-3) include other sulfonic acids or nitro compounds, depending on the specific reaction requirements. Isomers and analogs such as 2,6-dinitrobenzenesulfonic acid may be considered as substitutes based on the desired properties and reactivity.

About

English Name 2,4-Dinitrobenzenesulfonic acid hydrate
Molecular Formula C6H6N2O8S
Molecular Weight 266.19 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])S(=O)(=O)O.O
InChIKey GWGBNENHEGYJSN-UHFFFAOYSA-N
Last Updated: 2025-12-26 07:10

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,4-Dinitrobenzenesulfonic acid hydrate (CAS: 698999-22-3)?

2,4-Dinitrobenzenesulfonic acid hydrate (CAS: 698999-22-3) is regulated under the Globally Harmonize...

Compound Q&A

What is the market or research trend for 2,4-Dinitrobenzenesulfonic acid hydrate (CAS: 698999-22-3)?

The market for 2,4-Dinitrobenzenesulfonic acid hydrate (CAS: 698999-22-3) is driven by its applicati...

Compound Q&A

How should waste containing 2,4-Dinitrobenzenesulfonic acid hydrate (CAS: 698999-22-3) be handled?

Waste containing 2,4-Dinitrobenzenesulfonic acid hydrate (CAS: 698999-22-3) should be collected in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...