Compound Q&A

Are there alternatives to 2-Methyl-2-proanyl 3-[ethoxy(oxo)acetyl]-4-oxo-1-piperidinecarboxylate (CAS: 518990-24-4) in synthesis?

Answer

2-Methyl-2-propanyl 3-[ethoxy(oxo)acetyl]-4-oxo-1-piperidinecarboxylate
Alternative reagents such as 2-methyl-2-propanol or other similar compounds can be used as substitutes. However, the choice of alternative depends on the specific chemical reactions and desired end product, as each reagent may have different synthetic properties and reactivity.

About

English Name 2-Methyl-2-propanyl 3-[ethoxy(oxo)acetyl]-4-oxo-1-piperidinecarboxylate
Molecular Formula C14H21NO6
Molecular Weight 299.32 g/mol
SMILES CCOC(=O)C(=O)C1CN(CCC1=O)C(=O)OC(C)(C)C
InChIKey RSNKXJXWNHBZEU-UHFFFAOYSA-N
Last Updated: 2025-12-26 07:10

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-[ethoxy(oxo)acetyl]-4-oxo-1-piperidinecarboxylate (CAS: 518990-24-4)?

This compound should comply with the Globally Harmonized System of Classification and Labelling of C...

Compound Q&A

What is the market or research trend for 2-Methyl-2-proanyl 3-[ethoxy(oxo)acetyl]-4-oxo-1-piperidinecarboxylate (CAS: 518990-24-4)?

The compound is currently used in pharmaceutical and chemical research due to its unique chemical pr...

Compound Q&A

How should waste containing 2-Methyl-2-proanyl 3-[ethoxy(oxo)acetyl]-4-oxo-1-piperidinecarboxylate (CAS: 518990-24-4) be handled?

Waste containing this compound should be collected in appropriate containers and disposed of through...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...