Compound Q&A

What industries use 4'-Cyano-4-biphenylyl 4-pentylbenzoate (CAS: 59443-80-0)?

Answer

4'-Cyano-4-biphenylyl 4-pentylbenzoate
4'-Cyano-4-biphenylyl 4-pentylbenzoate (CAS: 59443-80-0) is used in the pharmaceutical industry for the synthesis of certain compounds due to its chemical functionality. It also finds applications in the polymer industry for modifying the properties of polymers. Additionally, it can be used in sensor technology and semiconductor fabrication processes, although these uses are more specialized and niche.

About

CAS No 59443-80-0
English Name 4'-Cyano-4-biphenylyl 4-pentylbenzoate
Molecular Formula C25H23NO2
Molecular Weight 369.5 g/mol
SMILES CCCCCC1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)C3=CC=C(C=C3)C#N
InChIKey IJKLNWDDXMHCFX-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Cyano-4-biphenylyl 4-pentylbenzoate (CAS: 59443-80-0)?

4'-Cyano-4-biphenylyl 4-pentylbenzoate (CAS: 59443-80-0) is a white crystalline solid with a molecul...

Compound Q&A

How is 4'-Cyano-4-biphenylyl 4-pentylbenzoate (CAS: 59443-80-0) typically synthesized?

4'-Cyano-4-biphenylyl 4-pentylbenzoate (CAS: 59443-80-0) is typically synthesized through a two-step...

Compound Q&A

What precautions should be taken when handling 4'-Cyano-4-biphenylyl 4-pentylbenzoate (CAS: 59443-80-0)?

When handling 4'-Cyano-4-biphenylyl 4-pentylbenzoate (CAS: 59443-80-0), it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...