Compound Q&A

What industries use Clerodermic Acid Methyl Ester (CAS: 67650-47-9)?

Answer

Clerodermic Acid Methyl Ester
Clerodermic Acid Methyl Ester is primarily used in the pharmaceutical industry for its potential as a bioactive compound. It also finds applications in the formulation of certain polymer-based coatings and in the production of certain types of sensors due to its unique chemical properties.

About

CAS No 67650-47-9
English Name Clerodermic Acid Methyl Ester
Molecular Formula C21H30O4
Molecular Weight 346.46 g/mol
SMILES CC1CCC2(C(C1(C)CCC3=CC(=O)OC3)CCC=C2C(=O)OC)C
InChIKey ZAOFNJDVAJQRBK-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Clerodermic Acid Methyl Ester (CAS: 67650-47-9)?

Clerodermic Acid Methyl Ester is a crystalline solid with a molecular weight of approximately 238.35...

Compound Q&A

How is Clerodermic Acid Methyl Ester (CAS: 67650-47-9) typically synthesized?

Clerodermic Acid Methyl Ester is usually synthesized by esterification of clerodermic acid with meth...

Compound Q&A

What precautions should be taken when handling Clerodermic Acid Methyl Ester (CAS: 67650-47-9)?

When handling Clerodermic Acid Methyl Ester, it is crucial to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...