Compound Q&A

What industries use Benzamide, N,N'-1,4-phenylenebis- (CAS: 5467-04-9)?

Answer

Benzamide, N,N'-1,4-phenylenebis-
Benzamide, N,N'-1,4-phenylenebis- (CAS: 5467-04-9) is used in the pharmaceutical industry for the synthesis of certain drugs, as a precursor in polymer chemistry for creating polyaniline-based materials, and in sensor technology due to its unique electronic properties.

About

CAS No 5467-04-9
English Name Benzamide, N,N'-1,4-phenylenebis-
Molecular Formula C20H16N2O2
Molecular Weight 316.36 g/mol
SMILES C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)NC(=O)C3=CC=CC=C3
InChIKey ABRHLWPJYNIPHN-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzamide, N,N'-1,4-phenylenebis- (CAS: 5467-04-9)?

Benzamide, N,N'-1,4-phenylenebis- (CAS: 5467-04-9) is a white crystalline solid with a molecular wei...

Compound Q&A

How is Benzamide, N,N'-1,4-phenylenebis- (CAS: 5467-04-9) typically synthesized?

Benzamide, N,N'-1,4-phenylenebis- (CAS: 5467-04-9) can be synthesized by the condensation of 1,4-ben...

Compound Q&A

What precautions should be taken when handling Benzamide, N,N'-1,4-phenylenebis- (CAS: 5467-04-9)?

When handling Benzamide, N,N'-1,4-phenylenebis- (CAS: 5467-04-9), it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...