Compound Q&A

How is (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid (CAS: 850589-47-8) typically synthesized?

Answer

(3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid
(3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid is typically synthesized via a multistep process from 3-chlorophenol and dimethylcarbamoyl chloride. The synthesis involves an acylation step followed by a boronation reaction. The process requires careful control of reaction conditions to achieve high yield and selectivity.

About

English Name (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid
Molecular Formula C9H11BClNO3
Molecular Weight 227.45600000000002 g/mol
SMILES B(C1=CC(=C(C=C1)C(=O)N(C)C)Cl)(O)O
InChIKey FRYXYHGYFIBOQR-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid (CAS: 850589-47-8)?

(3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid is a crystalline compound with a molecular weight...

Compound Q&A

What industries use (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid (CAS: 850589-47-8)?

(3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid (CAS: 850589-47-8)?

When handling (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid, safety goggles and gloves are esse...

Compound Q&A

What is Ethyl 3-cyclohexylpropanoate (CAS: 10094-36-7)?

Ethyl 3-cyclohexylpropanoate is a clear, colorless to light yellow liquid with a...

10094-36-7Ethyl 3-cyclohexylpr...
Compound Q&A

How should waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl)nicotinic acid (CAS: 34783-31-8) be handled?

Waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl...

34783-31-82-(Hydroxymethyl)-5-...
Compound Q&A

How should waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) be handled?

Waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) sho...

858-46-82,4,6-Tris(pentafluo...
Compound Q&A

What precautions should be taken when handling Chloroac-nle-oh (CAS: 56787-36-1)?

When handling Chloroac-nle-oh (CAS: 56787-36-1), it is essential to wear appropr...

56787-36-1Chloroac-nle-oh