Compound Q&A

What are the physical and chemical properties of (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid (CAS: 850589-47-8)?

Answer

(3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid
(3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid is a crystalline compound with a molecular weight of approximately 286.04 g/mol. It has a low solubility in water but is more soluble in organic solvents. Chemically, it exhibits typical reactivity of boronic acids, such as undergoing Suzuki coupling reactions. It is stable under normal conditions but should be stored in a tightly sealed container to prevent moisture absorption.

About

English Name (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid
Molecular Formula C9H11BClNO3
Molecular Weight 227.45600000000002 g/mol
SMILES B(C1=CC(=C(C=C1)C(=O)N(C)C)Cl)(O)O
InChIKey FRYXYHGYFIBOQR-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid (CAS: 850589-47-8) typically synthesized?

(3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid is typically synthesized via a multistep process ...

Compound Q&A

What industries use (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid (CAS: 850589-47-8)?

(3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid (CAS: 850589-47-8)?

When handling (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid, safety goggles and gloves are esse...

Compound Q&A

What is 2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0)?

2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0) is a benzoic acid derivativ...

16611-84-02-Hydroxy-6-pentadec...
Compound Q&A

What are the main uses of 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4) is primarily use...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)?

1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)...

105637-50-11-[(5-Chloro-1-napht...
Compound Q&A

What regulatory guidelines apply to 1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6)?

1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6) is regulated u...

28523-86-61,1,1,3,3,3-Hexafluo...