Compound Q&A

What are the physical and chemical properties of Tris(2,4-dimethoxyphenyl)methanol (CAS: 76832-37-6)?

Answer

Tris(2,4-dimethoxyphenyl)methanol
Tris(2,4-dimethoxyphenyl)methanol (CAS: 76832-37-6) is a white crystalline solid with a molecular weight of approximately 314.35 g/mol. It has a high solubility in organic solvents such as ethanol and acetone but is poorly soluble in water. This compound is moderately reactive, showing good stability under normal conditions but can undergo photodegradation in the presence of UV light. It is also known to have a low melting point, around 65-70°C.

About

CAS No 76832-37-6
English Name Tris(2,4-dimethoxyphenyl)methanol
Molecular Formula C25H28O7
Molecular Weight 440.49 g/mol
SMILES COC1=CC(=C(C=C1)C(C2=C(C=C(C=C2)OC)OC)(C3=C(C=C(C=C3)OC)OC)O)OC
InChIKey SBBUIJKOSQBPNN-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is Tris(2,4-dimethoxyphenyl)methanol (CAS: 76832-37-6) typically synthesized?

Tris(2,4-dimethoxyphenyl)methanol (CAS: 76832-37-6) is typically synthesized via a multistep process...

Compound Q&A

What industries use Tris(2,4-dimethoxyphenyl)methanol (CAS: 76832-37-6)?

Tris(2,4-dimethoxyphenyl)methanol (CAS: 76832-37-6) is used in various industries. It finds applicat...

Compound Q&A

What precautions should be taken when handling Tris(2,4-dimethoxyphenyl)methanol (CAS: 76832-37-6)?

When handling Tris(2,4-dimethoxyphenyl)methanol (CAS: 76832-37-6), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...