Compound Q&A

What are the physical and chemical properties of 5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid (CAS: 276684-04-9)?

Answer

5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid
5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid is a white to off-white solid with a molecular weight of 263.04 g/mol. It is poorly soluble in water but soluble in organic solvents like DMSO. The compound is known for its acidity and can form salts with bases. It is stable under normal conditions but reacts with strong reducing agents.

About

English Name 5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid
Molecular Formula C10H6Cl2N2O2
Molecular Weight 257.08 g/mol
SMILES C1=CC(=C(C=C1C2=NNC(=C2)C(=O)O)Cl)Cl
InChIKey KTLNOKUDBRHUIV-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

How is 5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid (CAS: 276684-04-9) typically synthesized?

5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid is usually synthesized via the condensation of ...

Compound Q&A

What industries use 5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid (CAS: 276684-04-9)?

5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid finds applications in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid (CAS: 276684-04-9)?

When handling 5-(3,4-Dichlorophenyl)-1H-pyrazole-3-carboxylic acid, wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...