Compound Q&A

What precautions should be taken when handling [4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid (CAS: 871329-69-0)?

Answer

[4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid
When handling [4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid (CAS: 871329-69-0), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat to protect against skin and eye contact. This compound should be stored in a fume hood to minimize exposure to air. In case of a spill, it should be cleaned up carefully using absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions to ensure safety in the laboratory environment.

About

English Name [4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid
Molecular Formula C10H14BNO4S2
Molecular Weight 287.2 g/mol
SMILES B(C1=CC=C(C=C1)S(=O)(=O)N2CCSCC2)(O)O
InChIKey ROGGFXZKSGGVQE-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid (CAS: 871329-69-0)?

[4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid (CAS: 871329-69-0) is a crystalline solid with a m...

Compound Q&A

How is [4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid (CAS: 871329-69-0) typically synthesized?

[4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid (CAS: 871329-69-0) is typically synthesized via a ...

Compound Q&A

What industries use [4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid (CAS: 871329-69-0)?

[4-(4-Thiomorpholinylsulfonyl)phenyl]boronic acid (CAS: 871329-69-0) finds applications in various i...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...