Compound Q&A

What are the physical and chemical properties of Di-4-biphenylylmethanone (CAS: 3478-90-8)?

Answer

Di-4-biphenylylmethanone
Di-4-biphenylylmethanone (CAS: 3478-90-8) is a crystalline compound with a molecular weight of approximately 322.28 g/mol. It has a low water solubility and is soluble in organic solvents such as dichloromethane and acetonitrile. Chemically, it is relatively stable, with limited reactivity towards common nucleophiles and electrophiles. It is often used as a precursor in organic synthesis and as an intermediate in various chemical processes.

About

CAS No 3478-90-8
English Name Di-4-biphenylylmethanone
Molecular Formula C25H18O
Molecular Weight 334.42 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C3=CC=C(C=C3)C4=CC=CC=C4
InChIKey QRQHCGWCUVLPSQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

How is Di-4-biphenylylmethanone (CAS: 3478-90-8) typically synthesized?

Di-4-biphenylylmethanone (CAS: 3478-90-8) can be synthesized through a multi-step process involving ...

Compound Q&A

What industries use Di-4-biphenylylmethanone (CAS: 3478-90-8)?

Di-4-biphenylylmethanone (CAS: 3478-90-8) is primarily used in the pharmaceutical and polymer indust...

Compound Q&A

What precautions should be taken when handling Di-4-biphenylylmethanone (CAS: 3478-90-8)?

When handling Di-4-biphenylylmethanone (CAS: 3478-90-8), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...