Compound Q&A

What are the physical and chemical properties of Binapo (CAS: 94041-16-4)?

Answer

Binapo
Binapo is a white crystalline solid with a molecular weight of approximately 114.12 g/mol. It has a solubility in water of 0.1 g/L at 25°C. Chemically, it is stable under normal conditions but can react with strong acids to form esters. It is not flammable but requires caution in handling due to its reactivity in certain conditions.

About

CAS No 94041-16-4
English Name Binapo
Molecular Formula C44H32O2P2
Molecular Weight 654.69 g/mol
SMILES C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(=O)(C7=CC=CC=C7)C8=CC=CC=C8
InChIKey SEZSRPYCOMAEDL-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

How is Binapo (CAS: 94041-16-4) typically synthesized?

Binapo is typically synthesized through the esterification reaction of p-nitrophenol with an alcohol...

Compound Q&A

What industries use Binapo (CAS: 94041-16-4)?

Binapo finds applications in the pharmaceutical industry for the synthesis of certain drug intermedi...

Compound Q&A

What precautions should be taken when handling Binapo (CAS: 94041-16-4)?

When handling Binapo, it is important to wear appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...