Compound Q&A

What are the physical and chemical properties of meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II) (CAS: 57774-14-8)?

Answer

meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II)
meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II) is a metalloporphyrin derivative with a molecular weight of approximately 675.27 g/mol. It has a crystalline form and is poorly soluble in water but soluble in organic solvents. This compound is known for its photophysical and photochemical properties, making it reactive under certain conditions.

About

CAS No 57774-14-8
English Name meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II)
Molecular Formula C44H26Cl4N4Ni
Molecular Weight 811.21 g/mol
SMILES Clc1ccc(cc1)C1=C2C=CC(=N2)C(=c2ccc(=C(C3=NC(=C(c4[nH]c1cc4)c1ccc(cc1)Cl)C=C3)c1ccc(cc1)Cl)[nH]2)c1ccc(cc1)Cl.[Ni]
InChIKey GSCAZALWBWGJQI-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

How is meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II) (CAS: 57774-14-8) typically synthesized?

meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II) is synthesized by first preparing the tetrakis(4-chlor...

Compound Q&A

What industries use meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II) (CAS: 57774-14-8)?

meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II) finds applications in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II) (CAS: 57774-14-8)?

When handling meso-Tetrakis(4-chlorophenyl)porphyrin-Ni(II), it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...