Compound Q&A

What industries use 2,4-Dichloro-5-iodoquinazoline (CAS: 959237-30-0)?

Answer

2,4-Dichloro-5-iodoquinazoline
2,4-Dichloro-5-iodoquinazoline is primarily used in the pharmaceutical industry for the development of new drugs. It also has potential applications in the synthesis of polymers and in the production of sensors and semiconductors due to its unique chemical properties. The compound's ability to form stable complexes makes it useful in various analytical and materials science applications.

About

English Name 2,4-Dichloro-5-iodoquinazoline
Molecular Formula C8H3Cl2IN2
Molecular Weight 324.9359999999999 g/mol
SMILES C1=CC2=C(C(=C1)I)C(=NC(=N2)Cl)Cl
InChIKey WHHOKNBNQDBGEU-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-5-iodoquinazoline (CAS: 959237-30-0)?

2,4-Dichloro-5-iodoquinazoline is a crystalline solid with a molecular weight of approximately 338.0...

Compound Q&A

How is 2,4-Dichloro-5-iodoquinazoline (CAS: 959237-30-0) typically synthesized?

2,4-Dichloro-5-iodoquinazoline is typically synthesized through a multi-step process involving the i...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-5-iodoquinazoline (CAS: 959237-30-0)?

When handling 2,4-Dichloro-5-iodoquinazoline, it is essential to wear appropriate personal protectiv...

Compound Q&A

How should waste containing 2-Ethyl-4-Methyl-1H-Imidazole-5-Carbaldehyde (CAS: 88634-80-4) be handled?

Waste containing 2-Ethyl-4-Methyl-1H-Imidazole-5-Carbaldehyde (CAS: 88634-80-4) ...

88634-80-42-Ethyl-4-Methyl-1H-...
Compound Q&A

What industries use Triethoxy(octyl)silane (CAS: 1385031-14-0)?

Triethoxy(octyl)silane (CAS: 1385031-14-0) is widely used in the pharmaceuticals...

1385031-14-0Triethoxy(octyl)sila...
Compound Q&A

Are there alternatives to 3-iodo-7-nitro-1H-indazole (CAS: 864724-64-1) in synthesis?

Several alternatives to 3-iodo-7-nitro-1H-indazole (CAS: 864724-64-1) exist in t...

864724-64-13-iodo-7-nitro-1H-in...
Compound Q&A

Are there alternatives to Benzene, bis[(trimethoxysilyl)ethyl] (CAS: 266317-71-9) in synthesis?

Yes, there are alternatives to Benzene, bis[(trimethoxysilyl)ethyl] (CAS: 266317...

266317-71-9Benzene, bis[(trimet...