Compound Q&A

How is 2,4-Dichloro-5-iodoquinazoline (CAS: 959237-30-0) typically synthesized?

Answer

2,4-Dichloro-5-iodoquinazoline
2,4-Dichloro-5-iodoquinazoline is typically synthesized through a multi-step process involving the iodination of 2,4-dichloroquinazoline followed by reaction with a suitable reagent. Common methods include the use of iodine in the presence of a catalyst like iron(III) chloride, leading to a high yield of the desired product. The synthesis requires precise control of reaction conditions to achieve high selectivity and yield.

About

English Name 2,4-Dichloro-5-iodoquinazoline
Molecular Formula C8H3Cl2IN2
Molecular Weight 324.9359999999999 g/mol
SMILES C1=CC2=C(C(=C1)I)C(=NC(=N2)Cl)Cl
InChIKey WHHOKNBNQDBGEU-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-5-iodoquinazoline (CAS: 959237-30-0)?

2,4-Dichloro-5-iodoquinazoline is a crystalline solid with a molecular weight of approximately 338.0...

Compound Q&A

What industries use 2,4-Dichloro-5-iodoquinazoline (CAS: 959237-30-0)?

2,4-Dichloro-5-iodoquinazoline is primarily used in the pharmaceutical industry for the development ...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-5-iodoquinazoline (CAS: 959237-30-0)?

When handling 2,4-Dichloro-5-iodoquinazoline, it is essential to wear appropriate personal protectiv...

Compound Q&A

How should waste containing 2-Ethyl-4-Methyl-1H-Imidazole-5-Carbaldehyde (CAS: 88634-80-4) be handled?

Waste containing 2-Ethyl-4-Methyl-1H-Imidazole-5-Carbaldehyde (CAS: 88634-80-4) ...

88634-80-42-Ethyl-4-Methyl-1H-...
Compound Q&A

What industries use Triethoxy(octyl)silane (CAS: 1385031-14-0)?

Triethoxy(octyl)silane (CAS: 1385031-14-0) is widely used in the pharmaceuticals...

1385031-14-0Triethoxy(octyl)sila...
Compound Q&A

Are there alternatives to 3-iodo-7-nitro-1H-indazole (CAS: 864724-64-1) in synthesis?

Several alternatives to 3-iodo-7-nitro-1H-indazole (CAS: 864724-64-1) exist in t...

864724-64-13-iodo-7-nitro-1H-in...
Compound Q&A

Are there alternatives to Benzene, bis[(trimethoxysilyl)ethyl] (CAS: 266317-71-9) in synthesis?

Yes, there are alternatives to Benzene, bis[(trimethoxysilyl)ethyl] (CAS: 266317...

266317-71-9Benzene, bis[(trimet...