Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2-fluorophenyl)carbamate (CAS: 98968-72-0)?

Answer

2-Methyl-2-propanyl (2-fluorophenyl)carbamate
2-Methyl-2-propanyl (2-fluorophenyl)carbamate (CAS: 98968-72-0) is a crystalline solid with a molecular weight of approximately 231.18 g/mol. It has a low solubility in water but is moderately soluble in organic solvents such as ethanol and acetone. The compound is known for its high reactivity, particularly towards nucleophiles. It is stable under normal conditions but sensitive to strong bases and reducing agents.

About

CAS No 98968-72-0
English Name 2-Methyl-2-propanyl (2-fluorophenyl)carbamate
Molecular Formula C11H14FNO2
Molecular Weight 211.24 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=CC=C1F
InChIKey AUHNQFOFWVWFTH-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (2-fluorophenyl)carbamate (CAS: 98968-72-0) typically synthesized?

2-Methyl-2-propanyl (2-fluorophenyl)carbamate can be synthesized via the reaction of 2-fluoroaniline...

Compound Q&A

What industries use 2-Methyl-2-propanyl (2-fluorophenyl)carbamate (CAS: 98968-72-0)?

2-Methyl-2-propanyl (2-fluorophenyl)carbamate (CAS: 98968-72-0) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (2-fluorophenyl)carbamate (CAS: 98968-72-0)?

When handling 2-Methyl-2-propanyl (2-fluorophenyl)carbamate (CAS: 98968-72-0), it is essential to us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...