Compound Q&A

What are the physical and chemical properties of (1S,11R,13S,14S,24R,26S)-13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione (CAS: 3463-92-1)?

Answer

(1S,11R,13S,14S,24R,26S)-13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione
This compound is a complex organic molecule with a high molecular weight and a crystalline structure. It is poorly soluble in water but soluble in organic solvents. Chemically, it is relatively stable but can react with strong acids or bases. Its properties make it useful in pharmaceutical and chemical applications.

About

CAS No 3463-92-1
English Name (1S,11R,13S,14S,24R,26S)-13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione
Molecular Formula C28H50N2O4
Molecular Weight 478.72 g/mol
SMILES CC1C2CCC(N1)CCCCCCCC(=O)OC3CCC(CCCCCCCC(=O)O2)NC3C
InChIKey AMSCMASJCYVAIF-QCVMBYIASA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is (1S,11R,13S,14S,24R,26S)-13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione (CAS: 3463-92-1) typically synthesized?

This compound is synthesized through a multi-step process involving ring formation, methylation, and...

Compound Q&A

What industries use (1S,11R,13S,14S,24R,26S)-13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione (CAS: 3463-92-1)?

This compound is primarily used in the pharmaceutical industry for drug development and in the polym...

Compound Q&A

What precautions should be taken when handling (1S,11R,13S,14S,24R,26S)-13,26-Dimethyl-2,15-dioxa-12,25-diazatricyclo[22.2.2.2~11,14~]triacontane-3,16-dione (CAS: 3463-92-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. W...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...