Compound Q&A

How is Cytidine 5'-(tetrahydrogen triphosphate) (CAS: 65-47-4) typically synthesized?

Answer

Cytidine 5'-(tetrahydrogen triphosphate)
Cytidine 5'-(tetrahydrogen triphosphate) is usually synthesized from cytidine by phosphorylation with tetrahydrogen triphosphate (TTP). This process involves the use of catalysts such as boron trifluoride or phosphoric acid to increase selectivity and yield. The reaction is typically carried out in an aqueous medium under mild conditions.

About

CAS No 65-47-4
English Name Cytidine 5'-(tetrahydrogen triphosphate)
Molecular Formula C9H16N3O14P3
Molecular Weight 483.16 g/mol
SMILES C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O
InChIKey PCDQPRRSZKQHHS-XVFCMESISA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cytidine 5'-(tetrahydrogen triphosphate) (CAS: 65-47-4)?

Cytidine 5'-(tetrahydrogen triphosphate) is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use Cytidine 5'-(tetrahydrogen triphosphate) (CAS: 65-47-4)?

Cytidine 5'-(tetrahydrogen triphosphate) is primarily used in the pharmaceutical industry for nucleo...

Compound Q&A

What precautions should be taken when handling Cytidine 5'-(tetrahydrogen triphosphate) (CAS: 65-47-4)?

When handling Cytidine 5'-(tetrahydrogen triphosphate), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...