Compound Q&A

What are the physical and chemical properties of (4-Formyl-1-naphthyl)boronic acid (CAS: 332398-52-4)?

Answer

(4-Formyl-1-naphthyl)boronic acid
(4-Formyl-1-naphthyl)boronic acid is a crystalline solid with a molecular weight of approximately 262.3 g/mol. It has limited water solubility and is more soluble in organic solvents. The compound exhibits typical reactivity of boronic acids, undergoing reactions such as Suzuki coupling with various aryl halides. Its solubility in common solvents and reactivity make it suitable for various synthetic applications.

About

English Name (4-Formyl-1-naphthyl)boronic acid
Molecular Formula C11H9BO3
Molecular Weight 200 g/mol
SMILES B(C1=CC=C(C2=CC=CC=C12)C=O)(O)O
InChIKey KBHGTTWVFRLPRO-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is (4-Formyl-1-naphthyl)boronic acid (CAS: 332398-52-4) typically synthesized?

(4-Formyl-1-naphthyl)boronic acid is often prepared via a condensation reaction between 1-naphthylbo...

Compound Q&A

What industries use (4-Formyl-1-naphthyl)boronic acid (CAS: 332398-52-4)?

(4-Formyl-1-naphthyl)boronic acid finds applications in pharmaceuticals, where it can serve as a bui...

Compound Q&A

What precautions should be taken when handling (4-Formyl-1-naphthyl)boronic acid (CAS: 332398-52-4)?

When handling (4-Formyl-1-naphthyl)boronic acid, it is important to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...