Compound Q&A

What are the physical and chemical properties of ethyl 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate (CAS: 80709-78-0)?

Answer

ethyl 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate
Ethyl 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate is a crystalline compound with a molecular weight of approximately 222.24 g/mol. It has a low water solubility and is moderately soluble in organic solvents like methanol and acetone. The compound is known for its reactivity, particularly in nucleophilic substitution reactions.

About

CAS No 80709-78-0
English Name ethyl 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate
Molecular Formula C10H11NO3
Molecular Weight 193.2 g/mol
SMILES CCOC(=O)C1=CC2=C(N1)C=C(O2)C
InChIKey GDOXDFUPXCOUGX-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is ethyl 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate (CAS: 80709-78-0) typically synthesized?

This compound is typically synthesized through the reaction of 2-methyl-4H-furo[3,2-b]pyrrole-5-carb...

Compound Q&A

What industries use ethyl 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate (CAS: 80709-78-0)?

This compound is used in the pharmaceutical industry for the synthesis of certain intermediates and ...

Compound Q&A

What precautions should be taken when handling ethyl 2-methyl-4H-furo[3,2-b]pyrrole-5-carboxylate (CAS: 80709-78-0)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat is necessary when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...