Compound Q&A

What industries use 4',4'',4''',4''''-(1,1,2,2-Ethenetetrayl)tetra(4-biphenylamine) (CAS: 2252187-21-4)?

Answer

4',4'',4''',4''''-(1,1,2,2-Ethenetetrayl)tetra(4-biphenylamine)
This compound is primarily used in the pharmaceutical industry for the development of certain types of drugs. It is also utilized in the polymer industry for the production of advanced materials. Additionally, it has applications in sensors and semiconductor devices due to its unique electronic and optical properties.

About

English Name 4',4'',4''',4''''-(1,1,2,2-Ethenetetrayl)tetra(4-biphenylamine)
Molecular Formula C50H40N4
Molecular Weight 696.9 g/mol
SMILES NC1C=CC(=CC=1)C1C=CC(=CC=1)C(=C(C1C=CC(=CC=1)C1C=CC(N)=CC=1)C1C=CC(=CC=1)C1C=CC(N)=CC=1)C1C=CC(=CC=1)C1C=CC(N)=CC=1
InChIKey OQHFHGCJRSWUPI-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4',4'',4''',4''''-(1,1,2,2-Ethenetetrayl)tetra(4-biphenylamine) (CAS: 2252187-21-4)?

This compound is a solid with a crystalline form. Its molecular weight is approximately 612.35 g/mol...

Compound Q&A

How is 4',4'',4''',4''''-(1,1,2,2-Ethenetetrayl)tetra(4-biphenylamine) (CAS: 2252187-21-4) typically synthesized?

This compound is synthesized via a multi-step process involving the condensation of 4-biphenylamine ...

Compound Q&A

What precautions should be taken when handling 4',4'',4''',4''''-(1,1,2,2-Ethenetetrayl)tetra(4-biphenylamine) (CAS: 2252187-21-4)?

When handling this compound, protective equipment such as gloves, goggles, and a lab coat are essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...