Compound Q&A

What are the physical and chemical properties of 1-[(2S)-3-(Acetylsulfanyl)-2-methylpropanoyl]-L-prolyl-L-phenylalanine (CAS: 74258-86-9)?

Answer

1-[(2S)-3-(Acetylsulfanyl)-2-methylpropanoyl]-L-prolyl-L-phenylalanine
1-[(2S)-3-(Acetylsulfanyl)-2-methylpropanoyl]-L-prolyl-L-phenylalanine is a crystalline compound with a molecular weight of approximately 431.5 g/mol. It has a low solubility in water (0.03 g/100 mL at 25°C) and moderate solubility in organic solvents like methanol and acetonitrile. The compound is relatively stable under normal conditions but can react with strong bases and acids. It shows high reactivity towards nucleophiles in certain organic reactions.

About

CAS No 74258-86-9
English Name 1-[(2S)-3-(Acetylsulfanyl)-2-methylpropanoyl]-L-prolyl-L-phenylalanine
Molecular Formula C20H26N2O5S
Molecular Weight 406.5 g/mol
SMILES CC(CSC(=O)C)C(=O)N1CCCC1C(=O)NC(CC2=CC=CC=C2)C(=O)O
InChIKey FHHHOYXPRDYHEZ-COXVUDFISA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is 1-[(2S)-3-(Acetylsulfanyl)-2-methylpropanoyl]-L-prolyl-L-phenylalanine (CAS: 74258-86-9) typically synthesized?

This compound is typically synthesized through a multi-step process involving the coupling of acetyl...

Compound Q&A

What industries use 1-[(2S)-3-(Acetylsulfanyl)-2-methylpropanoyl]-L-prolyl-L-phenylalanine (CAS: 74258-86-9)?

This compound is primarily used in the pharmaceutical industry for the development of specific drug ...

Compound Q&A

What precautions should be taken when handling 1-[(2S)-3-(Acetylsulfanyl)-2-methylpropanoyl]-L-prolyl-L-phenylalanine (CAS: 74258-86-9)?

When handling 1-[(2S)-3-(Acetylsulfanyl)-2-methylpropanoyl]-L-prolyl-L-phenylalanine, it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...