Compound Q&A

How is (2-Chloro-3-nitrophenyl)methanol (CAS: 89639-98-5) typically synthesized?

Answer

(2-Chloro-3-nitrophenyl)methanol
(2-Chloro-3-nitrophenyl)methanol can be synthesized by the reaction of 2-chloro-3-nitrobenzaldehyde with methanol in the presence of a strong acid catalyst like sulfuric acid. The process involves esterification, followed by reduction to form the alcohol. Yield and selectivity can be optimized with appropriate reaction conditions and catalysts.

About

CAS No 89639-98-5
English Name (2-Chloro-3-nitrophenyl)methanol
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)CO
InChIKey MOCPJIDJALBRIX-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Chloro-3-nitrophenyl)methanol (CAS: 89639-98-5)?

(2-Chloro-3-nitrophenyl)methanol is a crystalline solid at room temperature with a molecular weight ...

Compound Q&A

What industries use (2-Chloro-3-nitrophenyl)methanol (CAS: 89639-98-5)?

(2-Chloro-3-nitrophenyl)methanol finds applications in pharmaceuticals for the synthesis of intermed...

Compound Q&A

What precautions should be taken when handling (2-Chloro-3-nitrophenyl)methanol (CAS: 89639-98-5)?

Proper personal protective equipment (PPE) should be worn when handling (2-Chloro-3-nitrophenyl)meth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...