Compound Q&A

What industries use 3-(1,3-Thiazol-2-yl)-1H-indole (CAS: 135531-86-1)?

Answer

3-(1,3-Thiazol-2-yl)-1H-indole
3-(1,3-Thiazol-2-yl)-1H-indole is primarily used in the pharmaceutical and polymer industries. It serves as a precursor for the synthesis of various bioactive compounds, including drug candidates. In the polymer industry, it can be used as a stabilizer or in the development of new materials with specific properties.

About

English Name 3-(1,3-Thiazol-2-yl)-1H-indole
Molecular Formula C11H8N2S
Molecular Weight 200.266 g/mol
SMILES c1ccc2c(c1)c(c[nH]2)c3nccs3
InChIKey IYODIJVWGPRBGQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(1,3-Thiazol-2-yl)-1H-indole (CAS: 135531-86-1)?

3-(1,3-Thiazol-2-yl)-1H-indole is a yellow crystalline solid with a molecular weight of 220.25 g/mol...

Compound Q&A

How is 3-(1,3-Thiazol-2-yl)-1H-indole (CAS: 135531-86-1) typically synthesized?

3-(1,3-Thiazol-2-yl)-1H-indole can be synthesized through the condensation of indole with 2-thioacet...

Compound Q&A

What precautions should be taken when handling 3-(1,3-Thiazol-2-yl)-1H-indole (CAS: 135531-86-1)?

When handling 3-(1,3-Thiazol-2-yl)-1H-indole, it is crucial to wear appropriate personal protective ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...