Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate (CAS: 675112-67-1)?

Answer

2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate
2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate (CAS: 675112-67-1) is a colorless or white crystalline solid with a molecular weight of approximately 281.2 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and ethyl acetate. The compound is relatively stable but can react with strong bases. It is classified as a carbamate compound, which makes it susceptible to hydrolysis under basic conditions.

About

English Name 2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate
Molecular Formula C11H19F2NO2
Molecular Weight 235.27 g/mol
SMILES CC(C)(C)OC(=O)NC1CCC(CC1)(F)F
InChIKey OWELBZTXHNMEKC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate (CAS: 675112-67-1) typically synthesized?

2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate (CAS: 675112-67-1) can be synthesized via the ...

Compound Q&A

What industries use 2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate (CAS: 675112-67-1)?

2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate (CAS: 675112-67-1) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate (CAS: 675112-67-1)?

When handling 2-Methyl-2-propanyl (4,4-difluorocyclohexyl)carbamate (CAS: 675112-67-1), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...