Compound Q&A

What precautions should be taken when handling 3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide (CAS: 386273-25-2)?

Answer

3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide
When handling 3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, use appropriate equipment to contain and clean up the material, and ensure proper disposal according to safety data sheet (SDS) guidelines. Always work in a well-ventilated area or fume hood to minimize exposure.

About

English Name 3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide
Molecular Formula C16H14N2O3S
Molecular Weight 314.37 g/mol
SMILES CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC(=CC=C3)S(=O)(=O)N
InChIKey QHTHRXSCXPHAHP-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide (CAS: 386273-25-2)?

3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide is a solid crystalline compound with a molecula...

Compound Q&A

How is 3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide (CAS: 386273-25-2) typically synthesized?

3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide is typically synthesized via a multi-step proce...

Compound Q&A

What industries use 3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide (CAS: 386273-25-2)?

3-(5-Methyl-3-phenylisoxazol-4-yl)benzenesulfonamide is primarily used in the pharmaceutical industr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...