Compound Q&A

What are the physical and chemical properties of N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride (CAS: 28140-60-5)?

Answer

N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride
N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride has a crystalline form with a molecular weight of approximately 275.3 g/mol. It is slightly soluble in water and more soluble in organic solvents. Chemically, it displays basic properties due to its amine functionality and is known for its reactivity in nucleophilic substitution reactions.

About

CAS No 28140-60-5
English Name N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride
Molecular Formula C15H15ClN2
Molecular Weight 258.74 g/mol
SMILES C1=CC=C(C=C1)NC=CC=NC2=CC=CC=C2.Cl
InChIKey PBKBURVPAHHUIK-AVUWLFEKSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride (CAS: 28140-60-5) typically synthesized?

N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride is synthesized through the reaction of aniline ...

Compound Q&A

What industries use N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride (CAS: 28140-60-5)?

N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride (CAS: 28140-60-5)?

When handling N-(3-PhenyliMino-1-propen-1-yl)aniline hydrochloride, it is crucial to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...