Compound Q&A

What are the physical and chemical properties of 5-Chloro-1-methyl-1H-imidazole nitrate (1:1) (CAS: 4531-53-7)?

Answer

5-Chloro-1-methyl-1H-imidazole nitrate (1:1)
5-Chloro-1-methyl-1H-imidazole nitrate (1:1) has a crystalline form with a molecular weight of approximately 238.03 g/mol. It is slightly soluble in water and organic solvents. This compound exhibits good stability under normal conditions but can react with strong bases and acids. Care should be taken when handling due to its potential reactivity.

About

CAS No 4531-53-7
English Name 5-Chloro-1-methyl-1H-imidazole nitrate (1:1)
Molecular Formula C4H6ClN3O3
Molecular Weight 179.56 g/mol
SMILES CN1C=NC=C1Cl.[N+](=O)(O)[O-]
InChIKey PPAZZUWYNLCOAK-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 5-Chloro-1-methyl-1H-imidazole nitrate (1:1) (CAS: 4531-53-7) typically synthesized?

5-Chloro-1-methyl-1H-imidazole nitrate (1:1) is typically synthesized by reacting 5-chloro-1-methyl-...

Compound Q&A

What industries use 5-Chloro-1-methyl-1H-imidazole nitrate (1:1) (CAS: 4531-53-7)?

5-Chloro-1-methyl-1H-imidazole nitrate (1:1) is used in various industries, including pharmaceutical...

Compound Q&A

What precautions should be taken when handling 5-Chloro-1-methyl-1H-imidazole nitrate (1:1) (CAS: 4531-53-7)?

When handling 5-Chloro-1-methyl-1H-imidazole nitrate (1:1), it is important to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...