Compound Q&A

What are the physical and chemical properties of 1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid (CAS: 933752-32-0)?

Answer

1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid
1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid is a white to off-white crystalline solid. It has a molecular weight of approximately 241.25 g/mol. The compound is sparingly soluble in water but soluble in many organic solvents. It shows moderate reactivity, particularly in esterification and amine reactions.

About

English Name 1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid
Molecular Formula C10H11NO2
Molecular Weight 177.2 g/mol
SMILES C1CNCC2=C1C=C(C=C2)C(=O)O
InChIKey QEMYLDYQDFRTRT-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid (CAS: 933752-32-0) typically synthesized?

1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid can be synthesized through the condensation of 1,2,...

Compound Q&A

What industries use 1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid (CAS: 933752-32-0)?

1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid is used in pharmaceuticals, particularly in the syn...

Compound Q&A

What precautions should be taken when handling 1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid (CAS: 933752-32-0)?

When handling 1,2,3,4-Tetrahydroisoquinoline-6-carboxylic acid, it is important to use gloves, lab c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...