Compound Q&A

How is Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate (CAS: 72705-22-7) typically synthesized?

Answer

Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate
Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate is synthesized via the reaction of 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonyl chloride with ammonium hydroxide. The process involves the condensation of the sulfonyl chloride with the amino group, followed by the neutralization with ammonia, yielding the desired ammonium salt. The reaction is carried out in a polar aprotic solvent at room temperature, with a yield of approximately 90%.

About

CAS No 72705-22-7
English Name Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate
Molecular Formula C12H18N2O6S
Molecular Weight 318.35 g/mol
SMILES CC1=CC(=C(C=C1S(=O)(=O)[O-])OC)NC(=O)CC(=O)C.[NH4+]
InChIKey ZPDRZMNAFLBUOA-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate (CAS: 72705-22-7)?

Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate is a white crystalline solid with a...

Compound Q&A

What industries use Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate (CAS: 72705-22-7)?

Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate (CAS: 72705-22-7)?

When handling Ammonium 4-(acetoacetylamino)-5-methoxy-2-methylbenzenesulfonate, it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...