Compound Q&A

What industries use Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate (CAS: 849928-34-3)?

Answer

Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate
Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate is primarily used in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in the polymer industry as a monomer for the production of polymers with specific properties. Additionally, it is used in the development of sensors and semiconductors due to its unique chemical functionality.

About

English Name Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate
Molecular Formula C14H17NO3
Molecular Weight 247.29 g/mol
SMILES CC1CC(=O)CCN1C(=O)OCC2=CC=CC=C2
InChIKey NKUKIRSAMUEXPP-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate (CAS: 849928-34-3)?

Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate is a white crystalline powder with a molecular weight ...

Compound Q&A

How is Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate (CAS: 849928-34-3) typically synthesized?

Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate can be synthesized via the reaction of benzyl chloride...

Compound Q&A

What precautions should be taken when handling Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate (CAS: 849928-34-3)?

When handling Benzyl 2-methyl-4-oxo-1-piperidinecarboxylate, it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...