Compound Q&A

What are the main uses of 5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid (CAS: 117860-56-7)?

Answer

5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid
5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid is primarily used in the pharmaceutical industry for the synthesis of certain drugs and as a research reagent. It is also used in the chemical industry for organic synthesis and as a precursor in various chemical processes.

About

English Name 5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid
Molecular Formula C7H8N2O4
Molecular Weight 184.15099999999998 g/mol
SMILES CN1C(=CC(=N1)C(=O)O)C(=O)OC
InChIKey VMNNEPAQHIMLFM-UHFFFAOYSA-N
Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What is 5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid (CAS: 117860-56-7)?

5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid is a chemical compound with the CAS numbe...

Compound Q&A

Is 5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid (CAS: 117860-56-7) safe?

5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid is generally considered safe when handled...

Compound Q&A

How should 5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid (CAS: 117860-56-7) be stored?

5-(Methoxycarbonyl)-1-methyl-1H-pyrazole-3-carboxylic acid should be stored in a cool, dry place awa...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...