Compound Q&A

What is Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6)?

Answer

Methyl N-benzylalaninate hydrochloride (1:1)

Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6) is a derivative of alanine with a benzyl group and a methyl group attached to its nitrogen. It is a white crystalline powder with a pungent odor. This compound is characterized by its solubility in water and organic solvents.

About

CAS No 19460-85-6

English Name Methyl N-benzylalaninate hydrochloride (1:1)

Molecular Formula C11H16ClNO2

Molecular Weight 229.70700000000005 g/mol

SMILES CC(C(=O)OC)NCC1=CC=CC=C1.Cl

InChIKey FJUWPAKLUHULRE-FVGYRXGTSA-N

Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What are the main uses of Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6)?

Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6) is primarily used as a precursor in the syn...

Compound Q&A

Is Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6) safe?

Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6) is generally considered safe for use in pha...

Compound Q&A

How should Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6) be stored?

Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6) should be stored in a cool, dry place, away...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6)?

Answer

About

Related Q&A

What are the main uses of Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6)?

Is Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6) safe?

How should Methyl N-benzylalaninate hydrochloride (CAS: 19460-85-6) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

ShangHaiYiJi Industrial Co Ltd

ShangHaiMaiKeLinShengHuaKeJi Inc

ShenZhenAiTaHuaXue Co Ltd

Jin Jinle (Hunan) Chemical Co., Ltd.

ShangHaiYiJiShengWuKeJiYouXianGongSiXiaoShouBu

Shanghai Tengzhun BioScience Co., Ltd.