Compound Q&A

What are the main uses of Disodium 4,4'-(2,2-propanediyl)diphenolate (CAS: 2444-90-8)?

Answer

Disodium 4,4'-(2,2-propanediyl)diphenolate
Disodium 4,4'-(2,2-propanediyl)diphenolate is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in research for its chemical reactivity and stability. Additionally, it can be found in some industrial applications where its specific properties are advantageous.

About

CAS No 2444-90-8
English Name Disodium 4,4'-(2,2-propanediyl)diphenolate
Molecular Formula C15H14Na2O2
Molecular Weight 272.25 g/mol
SMILES CC(C)(C1=CC=C(C=C1)[O-])C2=CC=C(C=C2)[O-].[Na+].[Na+]
InChIKey WGMBWDBRVAKMOO-UHFFFAOYSA-L
Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What is Disodium 4,4'-(2,2-propanediyl)diphenolate (CAS: 2444-90-8)?

Disodium 4,4'-(2,2-propanediyl)diphenolate is a chemical compound with a CAS number of 2444-90-8. It...

Compound Q&A

Is Disodium 4,4'-(2,2-propanediyl)diphenolate (CAS: 2444-90-8) safe?

Disodium 4,4'-(2,2-propanediyl)diphenolate is generally considered safe when handled properly. Howev...

Compound Q&A

How should Disodium 4,4'-(2,2-propanediyl)diphenolate (CAS: 2444-90-8) be stored?

Disodium 4,4'-(2,2-propanediyl)diphenolate should be stored in a cool, dry place, away from direct s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...