Compound Q&A

What is (11bS)-8,9,10,11,12,13,14,15-Octahydro-4-hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]-4-oxide-dinaphtho[2,1-d] (CAS: 878111-20-7)?

Answer

(11bS)-8,9,10,11,12,13,14,15-Octahydro-4-hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]-4-oxide-dinaphtho[2,1-d
This compound is a derivative of dinaphtho[2,1-d] and is characterized by its unique structure and chemical properties. It contains an 8-membered ring system, a hydroxyl group, and two substituted phenyl rings. It is used in pharmaceuticals and chemical research for its specific functional groups and structural features.

About

English Name (11bS)-8,9,10,11,12,13,14,15-Octahydro-4-hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]-4-oxide-dinaphtho[2,1-d
Molecular Formula C50H65O4P
Molecular Weight 761.04 g/mol
SMILES CC(C)c1cc(c(c(c1)C(C)C)c2cc3c(c-4c2OP(=O)(Oc5c4c6c(cc5c7c(cc(cc7C(C)C)C(C)C)C(C)C)CCCC6)O)CCCC3)C(C)C
InChIKey CBAOKKLHEAPXIO-UHFFFAOYSA-N
Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What are the main uses of (11bS)-8,9,10,11,12,13,14,15-Octahydro-4-hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]-4-oxide-dinaphtho[2,1-d] (CAS: 878111-20-7)?

This compound is primarily used in pharmaceuticals as a precursor for drug synthesis due to its uniq...

Compound Q&A

Is (11bS)-8,9,10,11,12,13,14,15-Octahydro-4-hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]-4-oxide-dinaphtho[2,1-d] (CAS: 878111-20-7) safe?

This compound is generally safe under normal handling conditions. However, it should be used with ap...

Compound Q&A

How should (11bS)-8,9,10,11,12,13,14,15-Octahydro-4-hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]-4-oxide-dinaphtho[2,1-d] (CAS: 878111-20-7) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and sources of heat. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...