Compound Q&A

What are the main uses of 1-Chlorocarbonylferrocene (CAS: 1293-79-4)?

Answer

1-Chlorocarbonylferrocene
1-Chlorocarbonylferrocene (CAS: 1293-79-4) is primarily used in the synthesis of other organic compounds, particularly in the development of new materials and in academic research due to its unique electronic and magnetic properties. It is also explored for potential applications in catalysis and as a spectroscopic probe.

About

CAS No 1293-79-4
English Name 1-Chlorocarbonylferrocene
Molecular Formula C12H8Cl2FeO2
Molecular Weight 310.94 g/mol
SMILES [CH]1[CH][CH][C]([CH]1)C(=O)Cl.[CH]1[CH][CH][C]([CH]1)C(=O)Cl.[Fe]
InChIKey DPPPVFXCFVGRTG-UHFFFAOYSA-N
Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What is 1-Chlorocarbonylferrocene (CAS: 1293-79-4)?

1-Chlorocarbonylferrocene (CAS: 1293-79-4) is a complex organic compound derived from ferrocene with...

Compound Q&A

Is 1-Chlorocarbonylferrocene (CAS: 1293-79-4) safe?

1-Chlorocarbonylferrocene (CAS: 1293-79-4) is generally considered safe under controlled laboratory ...

Compound Q&A

How should 1-Chlorocarbonylferrocene (CAS: 1293-79-4) be stored?

1-Chlorocarbonylferrocene (CAS: 1293-79-4) should be stored in a cool, dry, and well-ventilated area...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...