Compound Q&A

What is Iron(2+) succinate (CAS: 10030-90-7)?

Answer

Iron(2+) succinate
Iron(2+) succinate is a complex compound formed by iron(II) ions chelated with succinate molecules. It has the chemical formula C4H4O4·Fe. This compound is characterized by its stability and water solubility, making it useful in various applications.

About

CAS No 10030-90-7
English Name Iron(2+) succinate
Molecular Formula C4H4FeO4
Molecular Weight 171.92 g/mol
SMILES C(CC(=O)[O-])C(=O)[O-].[Fe+2]
InChIKey MDXRFOWKIZPNTA-UHFFFAOYSA-L
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What are the main uses of Iron(2+) succinate (CAS: 10030-90-7)?

Iron(2+) succinate is commonly used as a dietary iron supplement, metal complex in pharmaceuticals, ...

Compound Q&A

Is Iron(2+) succinate (CAS: 10030-90-7) safe?

Iron(2+) succinate is generally considered safe for human consumption when used as a dietary supplem...

Compound Q&A

How should Iron(2+) succinate (CAS: 10030-90-7) be stored?

Iron(2+) succinate should be stored in a cool, dry place away from direct sunlight and heat sources....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...