Compound Q&A

What are the main uses of Methyl 3-(4-methylbenzenesulfonamido)benzoate (CAS: 173436-66-3)?

Answer

Methyl 3-(4-methylbenzenesulfonamido)benzoate
Methyl 3-(4-methylbenzenesulfonamido)benzoate is primarily used as a precursor in the synthesis of various pharmaceuticals, such as analgesics and anti-inflammatory drugs. It also serves as a chemical intermediate in the production of other compounds with similar functional groups. Additionally, it can be used in research for developing new drug candidates.

About

English Name Methyl 3-(4-methylbenzenesulfonamido)benzoate
Molecular Formula C15H15NO4S
Molecular Weight 305.36 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC(=C2)C(=O)OC
InChIKey CVKBYFCJQSPBOI-UHFFFAOYSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What is Methyl 3-(4-methylbenzenesulfonamido)benzoate (CAS: 173436-66-3)?

Methyl 3-(4-methylbenzenesulfonamido)benzoate is an organic compound with the CAS number 173436-66-3...

Compound Q&A

Is Methyl 3-(4-methylbenzenesulfonamido)benzoate (CAS: 173436-66-3) safe?

Methyl 3-(4-methylbenzenesulfonamido)benzoate is generally considered safe when handled with appropr...

Compound Q&A

How should Methyl 3-(4-methylbenzenesulfonamido)benzoate (CAS: 173436-66-3) be stored?

Methyl 3-(4-methylbenzenesulfonamido)benzoate should be stored in a cool, dry place away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...