Compound Q&A

What is Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS: 614731-09-8)?

Answer

Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate
Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS: 614731-09-8) is an organic compound with the molecular formula C11H17NO3F. It is known for its specific functional groups, including a tert-butyl group, a fluoro group, a formyl group, and a carboxylate group. This compound is often used in pharmaceutical and industrial applications due to its chemical properties.

About

English Name Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate
Molecular Formula C11H18FNO3
Molecular Weight 231.26699999999997 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)(C=O)F
InChIKey GRSPYCFNEDACGF-UHFFFAOYSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What are the main uses of Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS: 614731-09-8)?

Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS: 614731-09-8) is primarily used in pharmac...

Compound Q&A

Is Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS: 614731-09-8) safe?

Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS: 614731-09-8) is generally safe when handl...

Compound Q&A

How should Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS: 614731-09-8) be stored?

Tert-butyl 4-fluoro-4-formylpiperidine-1-carboxylate (CAS: 614731-09-8) should be stored in a cool, ...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene