Compound Q&A

What are the main uses of Indolizine-2-carboxylic acid (CAS: 3189-48-8)?

Answer

Indolizine-2-carboxylic acid
Indolizine-2-carboxylic acid is used primarily in the synthesis of various pharmaceuticals and organic compounds. It serves as a key intermediate in the production of biologically active molecules and is also utilized in research and development for drug discovery. Additionally, it may be used as a chemical reagent in academic and industrial settings.

About

CAS No 3189-48-8
English Name Indolizine-2-carboxylic acid
Molecular Formula C9H7NO2
Molecular Weight 161.16 g/mol
SMILES C1=CC2=CC(=CN2C=C1)C(=O)O
InChIKey QSJHENXHFPTGKD-UHFFFAOYSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What is Indolizine-2-carboxylic acid (CAS: 3189-48-8)?

Indolizine-2-carboxylic acid is an organic compound with the CAS number 3189-48-8. It is a derivativ...

Compound Q&A

Is Indolizine-2-carboxylic acid (CAS: 3189-48-8) safe?

Indolizine-2-carboxylic acid is generally considered safe when handled correctly. However, it should...

Compound Q&A

How should Indolizine-2-carboxylic acid (CAS: 3189-48-8) be stored?

Indolizine-2-carboxylic acid should be stored in a cool, dry place away from direct sunlight and hea...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A