Compound Q&A

How should 2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid (CAS: 851653-36-6) be stored?

Answer

2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid
2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid (Boc-DMAP) should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to store it in a tightly sealed container to prevent moisture absorption. The storage temperature should be maintained at 0-5°C to preserve its stability. Avoid contact with incompatible materials such as strong acids, bases, and oxidizing agents to ensure safety and prevent degradation.

About

English Name 2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid
Molecular Formula C10H20N2O4
Molecular Weight 232.28 g/mol
SMILES CC(C)(C)OC(=O)NC(CN(C)C)C(=O)O
InChIKey VCDQZVYJKDSORW-UHFFFAOYSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What is 2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid (CAS: 851653-36-6)?

2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid, also known as Boc-DMAP, is a chemica...

Compound Q&A

What are the main uses of 2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid (CAS: 851653-36-6)?

2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid (Boc-DMAP) is primarily used in organ...

Compound Q&A

Is 2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid (CAS: 851653-36-6) safe?

2-((tert-Butoxycarbonyl)amino)-3-(dimethylamino)propanoic acid (Boc-DMAP) is generally considered sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...